BMMCPD--m018
From Metabolomics.JP
(Difference between revisions)
Line 2: | Line 2: | ||
|SysName=Hetero-pyrithiamine | |SysName=Hetero-pyrithiamine | ||
|Common Name=&&Heteropyrithiamine&& | |Common Name=&&Heteropyrithiamine&& | ||
− | |CAS= | + | |CAS=30413-67-3 |
|KEGG=C02691 | |KEGG=C02691 | ||
}} | }} |
Revision as of 09:00, 14 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 30413-67-3 |
KEGG | C02691 |
KNApSAcK | |
CDX file | |
MOL file | BMMCPD--m018.mol |
Heteropyrithiamine | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Hetero-pyrithiamine |
Common Name |
|
Symbol | |
Formula | C11H13N4 |
Exact Mass | 201.114 |
Average Mass | 201.2478 |
SMILES | Cc(n2)nc(N)c(c2)C[n+1](c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways