BMMCAS--d013
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Bis(4'-chlorophenyl)-methane | + | |SysName=Bis (4'-chlorophenyl) -methane |
| − | |Common Name=&&Bis(4'-chlorophenyl)methane&&DDM&& | + | |Common Name=&&Bis (4'-chlorophenyl) methane&&DDM&& |
|CAS=101-76-8 | |CAS=101-76-8 | ||
|KEGG=C06641 | |KEGG=C06641 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 101-76-8 |
| KEGG | C06641 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCAS--d013.mol |
| Bis (4'-chlorophenyl) methane | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Bis (4'-chlorophenyl) -methane |
| Common Name |
|
| Symbol | |
| Formula | C13H10Cl2 |
| Exact Mass | 236.0159 |
| Average Mass | 237.1239 |
| SMILES | Clc(c2)ccc(c2)Cc(c1)ccc(Cl)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
