BMMCACXXo004
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 550-45-8 |
KEGG | D00103 |
KNApSAcK | |
CDX file | |
MOL file | BMMCACXXo004.mol |
![]() | |
Structural Information | |
Systematic Name | Iridodial |
Common Name | |
Symbol | |
Formula | C10H16O2 |
Exact Mass | 168.115 |
Average Mass | 168.2328 |
SMILES | O=CC(C)[C@@H](C1)[C@H](C=O)[C@@H](C)C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |