BMMCACCHq003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(+)-Neomenthol | + | |SysName= (+) -Neomenthol |
| − | |Common Name=&&(+)-Neomenthol&& | + | |Common Name=&& (+) -Neomenthol&& |
|CAS=15356-60-2 | |CAS=15356-60-2 | ||
|KEGG=C00553 | |KEGG=C00553 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 15356-60-2 |
| KEGG | C00553 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCACCHq003.mol |
| (+) -Neomenthol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (+) -Neomenthol |
| Common Name |
|
| Symbol | |
| Formula | C10H20O |
| Exact Mass | 156.1514 |
| Average Mass | 156.2652 |
| SMILES | C[C@H](C1)C[C@H](O)[C@@H](C1)C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
