BMFYB6DAk009
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 950905-92-7 |
KEGG | C05533 |
KNApSAcK | |
CDX file | |
MOL file | BMFYB6DAk009.mol |
Oxaloglutarate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Oxaloglutaric acid |
Common Name |
|
Symbol | |
Formula | C7H8O7 |
Exact Mass | 204.027 |
Average Mass | 204.1342 |
SMILES | OC(=O)CCC(C(O)=O)C(=O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |