BMFYB5CAe005
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(R)-Mevalonic acid 5-diphosphate | + | |SysName= (R) -Mevalonic acid 5-diphosphate |
| − | |Common Name=&&(R)-5-Diphosphomevalonate&& | + | |Common Name=&& (R) -5-Diphosphomevalonate&& |
|CAS=? | |CAS=? | ||
|KEGG=C01143 | |KEGG=C01143 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C01143 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYB5CAe005.mol |
| (R) -5-Diphosphomevalonate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R) -Mevalonic acid 5-diphosphate |
| Common Name |
|
| Symbol | |
| Formula | C6H14O10P2 |
| Exact Mass | 308.0062 |
| Average Mass | 308.1168 |
| SMILES | OC(=O)C[C@@](C)(O)CCOP(O)(=O)OP(O)(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
