BMCCPUXA0001
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 3545-76-4 |
KEGG | C00943 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPUXA0001.mol |
![]() | |
Structural Information | |
Systematic Name | 3',5'-Cyclic IMP |
Common Name | |
Symbol | |
Formula | C10H11N4O7P |
Exact Mass | 330.0365 |
Average Mass | 330.1908 |
SMILES | O=C(N4)c(n3)c(N=C4)n(c3)[C@H](O1)[C@H](O)[C@H](O2) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |