BMAXS3AKf007
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=Pantetheine | |SysName=Pantetheine | ||
| − | |Common Name=&&Pantetheine&&(R)-Pantetheine&& | + | |Common Name=&&Pantetheine&& (R) -Pantetheine&& |
|CAS=496-65-1 | |CAS=496-65-1 | ||
|KEGG=C00831 | |KEGG=C00831 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 496-65-1 |
| KEGG | C00831 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXS3AKf007.mol |
| Pantetheine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Pantetheine |
| Common Name |
|
| Symbol | |
| Formula | C11H22N2O4S |
| Exact Mass | 278.13 |
| Average Mass | 278.3694 |
| SMILES | SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
