BMACIZ--e004
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 25679-93-0 |
| KEGG | C01100 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMACIZ--e004.mol |
| L-Histidinol phosphate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-Histidinol phosphate |
| Common Name |
|
| Symbol | |
| Formula | C6H12N3O4P |
| Exact Mass | 221.0565 |
| Average Mass | 221.151 |
| SMILES | N[C@@H](Cc(c1)ncn1)COP(O)(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
