BMACID--r003
From Metabolomics.JP
(Difference between revisions)
m (BMAXCCIDr003 moved to BMACID--r003) |
Revision as of 13:00, 8 September 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 526-31-8 |
| KEGG | C02983 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMACID--r003.mol |
| L-2-Methyltryptophan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-2-Methyl-tryptophan |
| Common Name |
|
| Symbol | |
| Formula | C12H14N2O2 |
| Exact Mass | 218.1055 |
| Average Mass | 218.2518 |
| SMILES | CN[C@H](C(O)=O)Cc(c1)c(c2)c(ccc2)n1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
