Magnolol
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=5,5'-Di-2-propen-1-yl-[1,1'-biphenyl]-2,2'-diol |Common Name=&&2,2'-Bichavicol&&5,5'-Diallyl-2,2'-biphenyldiol&&5,5'-di-2-Propenyl-[1,1'-b...) |
|||
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,5'-Di-2-propen-1-yl-[1,1'-biphenyl]-2,2'-diol | |SysName=5,5'-Di-2-propen-1-yl-[1,1'-biphenyl]-2,2'-diol | ||
| − | |Common Name=&&2,2'-Bichavicol&&5,5'-Diallyl-2,2'-biphenyldiol&&5,5'- | + | |Common Name=&&2,2'-Bichavicol&&5,5'-Diallyl-2,2'-biphenyldiol&&5,5'-Di-2-propenyl-[1,1'-biphenyl]-2,2'-diol&&5,5'-Diallyl-2,2'-biphenyldiol&&Magnolol&& |
|CAS=528-43-8 | |CAS=528-43-8 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Revision as of 09:30, 10 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 528-43-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Magnolol.mol |
| 2,2'-Bichavicol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,5'-Di-2-propen-1-yl-[1,1'-biphenyl]-2,2'-diol |
| Common Name |
|
| Symbol | |
| Formula | C18H18O2 |
| Exact Mass | 266.13067982 |
| Average Mass | 266.33432 |
| SMILES | C=CCc(c2)cc(c(O)c2)c(c1)c(O)ccc(CC=C)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
