LBF23000BC02
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0247 | |LipidBank=DFA0247 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0247 |
LipidMaps | LMFA01020022 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF23000BC02.mol |
![]() | |
Structural Information | |
Systematic Name | 3, 13, 19-Trimethyltricosanoic acid |
Common Name | |
Symbol | |
Formula | C26H52O2 |
Exact Mass | 396.396730908 |
Average Mass | 396.68987999999996 |
SMILES | CCCCC(C)CCCCCC(C)CCCCCCCCCC(C)CC(O)=O |
Physicochemical Information | |
Melting Point | -8°C |
Boiling Point | 208°C at 760mmHg |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | <<0111>><<0112>><<0395>><<0457>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |