LBF20406HO16
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8134 | |LipidBank=DFA8134 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA8134 |
| LipidMaps | LMFA03060028 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406HO16.mol |
| |
| Structural Information | |
| Systematic Name | 11R-hydroxy-5Z,8Z,12E,14Z-eicosatetraenoic acid |
| Common Name | |
| Symbol | |
| Formula | C20H32O3 |
| Exact Mass | 320.23514489 |
| Average Mass | 320.46628 |
| SMILES | C(CC=CC=C[C@@H](CC=CCC=CCCCC(O)=O)O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax: 235nm e: 27,000 |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
