LBF202nnPG05
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR1729 | |LipidBank=XPR1729 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR1729 |
LipidMaps | LMFA03010033 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF202nnPG05.mol |
13,14-dihydro-15-keto Prostaglandin A2 | |
---|---|
Structural Information | |
Systematic Name | 9-oxo-15R-hydroxy-prostsa-10,13E-dien-1-oic acid |
Common Name |
|
Symbol | |
Formula | C20H30O4 |
Exact Mass | 334.21440944799997 |
Average Mass | 334.4498 |
SMILES | C(CCC(=O)CC[C@H]([C@H]1CC=CCCCC(O)=O)C=CC(=O)1)CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |