LBF18403SC03
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0208 | |LipidBank=DFA0208 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0208 |
| LipidMaps | LMFA01030169 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18403SC03.mol |
| |
| Structural Information | |
| Systematic Name | 6, 9, 12, 15-Octadecatetraenoic acid |
| Common Name | |
| Symbol | |
| Formula | C18H28O2 |
| Exact Mass | 276.20893014 |
| Average Mass | 276.41372 |
| SMILES | CCC=CCC=CCC=CCC=CCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | -57.4 to -56.6°C |
| Boiling Point | |
| Density | |
| Optical Rotation | 14888 at 16°C |
| Reflactive Index | |
| Solubility | soluble in carbon disulfide and methyl alcohol.<<0269>><<0350>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
