LBF183nnXX01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0266 | |LipidBank=DFA0266 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0266 |
| LipidMaps | LMFA01030197 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF183nnXX01.mol |
| Gorlic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-Cyclopentene-1-tridecenoic acid / 13- (2-cyclopenten-1-yl) tridecenoic acid / 13- (Cyclopent-2-enyl) -6-tridecenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | OC(=O)CCCCC=CCCCCCCC(C1)C=CC1 |
| Physicochemical Information | |
| Melting Point | 6.0 °C [Liquid] |
| Boiling Point | 232.5 °C |
| Density | dX4250.9436 |
| Optical Rotation | 1.4782 at 25 °C |
| Reflactive Index | |
| Solubility | soluble in hot ethanol.<<0048>><<0107>><<0401>><<0402>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
