LBF18307HO01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8146 | |LipidBank=DFA8146 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8146 |
LipidMaps | LMFA01050145 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18307HO01.mol |
![]() | |
Structural Information | |
Systematic Name | 13S-hydroxy-6Z,9Z,11E-octadecatrienoic acid |
Common Name | |
Symbol | |
Formula | C18H30O3 |
Exact Mass | 294.21949482599996 |
Average Mass | 294.429 |
SMILES | CCCCCC(O)C=CC=CCC=CCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax: 235nm e: 23,000 |
IR Spectra | |
NMR Spectra | |
Chromatograms |