LBF18203JA02
From Metabolomics.JP
(Difference between revisions)
m (LBF18203OP01 moved to LBF18203JA02) |
|||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8159 | |LipidBank=DFA8159 | ||
Latest revision as of 21:33, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA8159 |
| LipidMaps | LMFA02010001 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18203JA02.mol |
| 12-oxo-phytodienoic acid | |
|---|---|
| File:LBF18203JA02.png | |
| Structural Information | |
| Systematic Name | 4-oxo-5beta- (2Z-pentenyl) -2-cyclopentene-1beta-octanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H28O3 |
| Exact Mass | 292.203844762 |
| Average Mass | 292.41312 |
| SMILES | C(CC=CCC)(C(=O)1)C(CCCCCCCC(O)=O)C=C1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |