FLII1LNI0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5-(3-Methyl-2-butenyl)-2-(2,4-dihydroxyphenyl)-4,6-dimethoxybenzofuran | + | |SysName=5- (3-Methyl-2-butenyl) -2- (2,4-dihydroxyphenyl) -4,6-dimethoxybenzofuran |
| − | |Common Name=&&Gancaonin I&&5-(3-Methyl-2-butenyl)-2-(2,4-dihydroxyphenyl)-4,6-dimethoxybenzofuran&& | + | |Common Name=&&Gancaonin I&&5- (3-Methyl-2-butenyl) -2- (2,4-dihydroxyphenyl) -4,6-dimethoxybenzofuran&& |
|CAS=126716-36-7 | |CAS=126716-36-7 | ||
|KNApSAcK=C00010077 | |KNApSAcK=C00010077 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 126716-36-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLII1LNI0002.mol |
| Gancaonin I | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5- (3-Methyl-2-butenyl) -2- (2,4-dihydroxyphenyl) -4,6-dimethoxybenzofuran |
| Common Name |
|
| Symbol | |
| Formula | C21H22O5 |
| Exact Mass | 354.146723814 |
| Average Mass | 354.39638 |
| SMILES | COc(c(CC=C(C)C)3)cc(o1)c(c3OC)cc(c(c2)c(O)cc(O)c2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
