FLIF1LGF0005
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=2-Hydroxy-2-(1,2,6a,12a-tetrahydro-8,9-dimethoxy-12H-[1]benzopyrano[4,3-b]furo[3,2-f][1,4]benzodioxin-2-yl)propyl 6-O-alpha-L-arabinopyranosyl-beta-D-glucopyranoside |
|Common Name=&&Amorphigenol O-vicianoside&&Amorphol&& | |Common Name=&&Amorphigenol O-vicianoside&&Amorphol&& | ||
|CAS=53947-91-4 | |CAS=53947-91-4 | ||
|KNApSAcK=C00010180 | |KNApSAcK=C00010180 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 53947-91-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIF1LGF0005.mol |
| Amorphigenol O-vicianoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C34H42O17 |
| Exact Mass | 722.242199918 |
| Average Mass | 722.6870799999999 |
| SMILES | O(C75)c(c(C(=O)C(c(c(OC7)6)cc(c(OC)c6)OC)5)1)c(C2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
