FLID1ANP0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=(6aS,11aS)-6a,11a-Dihydro-9-methoxy-2,2-dimethyl-2H,6H-benzofuro[3,2-c]pyrano[2,3-h][1]benzopyran |
|Common Name=&&Hemileiocarpin&& | |Common Name=&&Hemileiocarpin&& | ||
|CAS=66446-92-2 | |CAS=66446-92-2 | ||
|KNApSAcK=C00009643 | |KNApSAcK=C00009643 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 66446-92-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLID1ANP0003.mol |
Hemileiocarpin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C21H20O4 |
Exact Mass | 336.136159128 |
Average Mass | 336.38109999999995 |
SMILES | C(C52)(COc(c54)c(c(cc4)3)C=CC(C)(C)O3)c(c1)c(O2)cc |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|