FLIAEANS0006
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=7-O-Methyltectorigenin | + | |SysName=7-O-Methyltectorigenin |
|Common Name=&&7-O-Methyltectorigenin&&5,4'-Dihydroxy-6,7-dimethoxyisoflavone&& | |Common Name=&&7-O-Methyltectorigenin&&5,4'-Dihydroxy-6,7-dimethoxyisoflavone&& | ||
|CAS=1096-58-8 | |CAS=1096-58-8 | ||
|KNApSAcK=C00009463 | |KNApSAcK=C00009463 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1096-58-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIAEANS0006.mol |
7-O-Methyltectorigenin | |
---|---|
Structural Information | |
Systematic Name | 7-O-Methyltectorigenin |
Common Name |
|
Symbol | |
Formula | C17H14O6 |
Exact Mass | 314.07903818 |
Average Mass | 314.28945999999996 |
SMILES | COc(c1)c(OC)c(O)c(C(=O)2)c(OC=C(c(c3)ccc(O)c3)2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|