FLIAABNS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
| {{Metabolite | {{Metabolite | ||
| |SysName=5,7-Dihydroxy-4'-methoxyisoflavone | |SysName=5,7-Dihydroxy-4'-methoxyisoflavone | ||
| − | |Common Name=&&Biochanin A&&Genistein 4'-methyl ether&& | + | |Common Name=&&Biochanin A&&Pratensol&&Olmelin&&Genistein 4'-methyl ether&&4'-Methylgenistein&& | 
| |CAS=491-80-5 | |CAS=491-80-5 | ||
| |KNApSAcK=C00002510 | |KNApSAcK=C00002510 | ||
| }} | }} | ||
Latest revision as of 16:41, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAAB Biochanin A (10 pages) : FLIAABNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 491-80-5 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAABNS0001.mol | 
| Biochanin A | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-4'-methoxyisoflavone | 
| Common Name | 
 | 
| Symbol | |
| Formula | C16H12O5 | 
| Exact Mass | 284.068473494 | 
| Average Mass | 284.26348 | 
| SMILES | COc(c3)ccc(c3)C(=C2)C(=O)c(c(O)1)c(O2)cc(O)c1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
