FLIA2ANS0001
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=7-Hydroxy-6-methoxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one | + | |SysName=7-Hydroxy-6-methoxy-3- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Afromosin&&Afrormosin&&Castanin | + | |Common Name=&&Afromosin&&Afrormosin&&Castanin&& |
|CAS=550-79-8 | |CAS=550-79-8 | ||
|KNApSAcK=C00002507 | |KNApSAcK=C00002507 | ||
}} | }} | ||
Latest revision as of 11:46, 2 February 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA2A Demethyltexasin and O-methyl derivatives (11 pages) : FLIA2ANS Simple substitution (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 550-79-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA2ANS0001.mol |
| Afromosin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-6-methoxy-3- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O5 |
| Exact Mass | 298.084123558 |
| Average Mass | 298.29006 |
| SMILES | COc(c3)ccc(c3)C(=C2)C(=O)c(c1)c(O2)cc(O)c(OC)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
