FL6FDANC0001
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=4'-Hydroxy-4-(4-hydroxystyryl)-5,7-dimethoxyflavan | + | |SysName=4'-Hydroxy-4- (4-hydroxystyryl) -5,7-dimethoxyflavan |
| − | |Common Name=&&4'-Hydroxy-4-(4-hydroxystyryl)-5,7-dimethoxyflavan&& | + | |Common Name=&&4'-Hydroxy-4- (4-hydroxystyryl) -5,7-dimethoxyflavan&& |
|CAS=63524-12-9 | |CAS=63524-12-9 | ||
|KNApSAcK=C00009320 | |KNApSAcK=C00009320 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6FDA 4'-Hydroxy-5,7-dimethoxyflavan (2 pages) : FL6FDANC Flavonoid substituted by complex substituent (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 63524-12-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6FDANC0001.mol |
| 4'-Hydroxy-4- (4-hydroxystyryl) -5,7-dimethoxyflavan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4'-Hydroxy-4- (4-hydroxystyryl) -5,7-dimethoxyflavan |
| Common Name |
|
| Symbol | |
| Formula | C25H24O5 |
| Exact Mass | 404.162373878 |
| Average Mass | 404.45506 |
| SMILES | C(=Cc(c4)ccc(O)c4)[C@H](c21)C[C@H](c(c3)ccc(c3)O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
