FL6FCANM0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=5,4'-Dihydroxy-7'-methoxy-8-methylflavan | |SysName=5,4'-Dihydroxy-7'-methoxy-8-methylflavan | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6FCA 5,4'-Dihydroxy-7-methoxyflavan (0 pages) : FL6FCANM C-Methyl or C2/C3 substituted (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 84638-52-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6FCANM0001.mol |
| 5,4'-Dihydroxy-7'-methoxy-8-methylflavan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,4'-Dihydroxy-7'-methoxy-8-methylflavan |
| Common Name |
|
| Symbol | |
| Formula | C17H18O4 |
| Exact Mass | 286.120509064 |
| Average Mass | 286.32241999999997 |
| SMILES | COc(c1)c(C)c(O2)c(CC[C@H]2c(c3)ccc(O)c3)c(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
