FL5FGCNS0006
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
| − | |  | + | |SysName=3,5,3',4'-Tetrahydroxy-6,7,8-trimethoxyflavone  | 
| − | |Common Name=&&3,5,3',4'-Tetrahydroxy-6,7,8-trimethoxyflavone &&  | + | |Common Name=&&3,5,3',4'-Tetrahydroxy-6,7,8-trimethoxyflavone&&  | 
|CAS=102673-79-0  | |CAS=102673-79-0  | ||
|KNApSAcK=C00004791  | |KNApSAcK=C00004791  | ||
}}  | }}  | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FGC 5,6,7,8,3',4'-Hexahydroxyflavonol and O-methyl derivatives (36 pages) : FL5FGCNS Simple substitution (28 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 102673-79-0 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FGCNS0006.mol | 
| 3,5,3',4'-Tetrahydroxy-6,7,8-trimethoxyflavone | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 3,5,3',4'-Tetrahydroxy-6,7,8-trimethoxyflavone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C18H16O9 | 
| Exact Mass | 376.07943210999997 | 
| Average Mass | 376.31424 | 
| SMILES |  c(C(O2)=C(C(c(c3O)c2c(c(c3OC)OC)OC)=O)O)(c1)cc(O)c | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
