FL5FF9NI0001
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7,8-Trihydroxy-3-methoxyflavone 8-(2-methylbutyrate) | + | |SysName=5,7,8-Trihydroxy-3-methoxyflavone 8- (2-methylbutyrate) |
| − | |Common Name=&&8-Hydroxygalangin 3-methyl ether 8-methylbutyrate&&5,7,8-Trihydroxy-3-methoxyflavone 8-(2-methylbutyrate)&& | + | |Common Name=&&8-Hydroxygalangin 3-methyl ether 8-methylbutyrate&&5,7,8-Trihydroxy-3-methoxyflavone 8- (2-methylbutyrate) && |
|CAS=128508-14-5 | |CAS=128508-14-5 | ||
|KNApSAcK=C00004914 | |KNApSAcK=C00004914 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FF9 5,7,8,(3'),(5')-Hydroxyflavonol and O-methyl derivatives (26 pages) : FL5FF9NI Non-cyclic prenyl substituted (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 128508-14-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FF9NI0001.mol |
| 8-Hydroxygalangin 3-methyl ether 8-methylbutyrate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,8-Trihydroxy-3-methoxyflavone 8- (2-methylbutyrate) |
| Common Name |
|
| Symbol | |
| Formula | C21H20O7 |
| Exact Mass | 384.120902994 |
| Average Mass | 384.37929999999994 |
| SMILES | COC(C3=O)=C(Oc(c23)c(OC(=O)C(C)CC)c(O)cc2O)c(c1)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
