FL5F19NP0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
|SysName=3-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-benzo [ 1,2-b:3,4-b' ] dipyran-4-one  | |SysName=3-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-benzo [ 1,2-b:3,4-b' ] dipyran-4-one  | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5F19 7,(3'),(5')-Hydroxyflavonol and O-methyl derivatives (4 pages) : FL5F19NP Pyranoflavonoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 38070-93-8 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5F19NP0001.mol | 
| Karanjachromene | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 3-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-benzo [ 1,2-b:3,4-b' ] dipyran-4-one | 
| Common Name | 
  | 
| Symbol | |
| Formula | C21H18O4 | 
| Exact Mass | 334.120509064 | 
| Average Mass | 334.36521999999997 | 
| SMILES |  COC(C(=O)2)=C(Oc(c34)c2ccc(OC(C=C4)(C)C)3)c(c1)ccc | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
