FL3FF9NS0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=7-Hydroxy-5,8-Dimethoxyflavone | |SysName=7-Hydroxy-5,8-Dimethoxyflavone | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FF9 5,7,8,(3'),(5')-Hydroxyflavone O-methyl derivatives (17 pages) : FL3FF9NS Simple substitution (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3316-54-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FF9NS0003.mol |
| Norwogonin 5,8-dimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-5,8-Dimethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C17H14O5 |
| Exact Mass | 298.084123558 |
| Average Mass | 298.29006 |
| SMILES | COc(c1)c(C(=O)3)c(OC(=C3)c(c2)cccc2)c(OC)c(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
