FL3FEANS0002
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5,6,7-Trihydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Scutellarein&& | + | |Common Name=&&Scutellarein&&5,6,7-Trihydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one&& |
|CAS=529-53-3 | |CAS=529-53-3 | ||
|KNApSAcK=C00003834 | |KNApSAcK=C00003834 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEA Scutellarein and O-methyl derivatives (71 pages) : FL3FEANS Simple substitution (14 pages) : FL3FEANS0 Normal (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 529-53-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FEANS0002.mol |
| Scutellarein | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,6,7-Trihydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H10O6 |
| Exact Mass | 286.047738052 |
| Average Mass | 286.2363 |
| SMILES | Oc(c3)ccc(c3)C(=C2)Oc(c1)c(C(=O)2)c(O)c(O)c(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
