FL3FE9NS0006
From Metabolomics.JP
(Difference between revisions)
| (8 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=2-Phenyl-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Baicalein 5,6,7-trimethyl ether&& | + | |Common Name=&&5,6,7-Trimethoxyflavone&&Baicalein 5,6,7-trimethyl ether&&2-Phenyl-5,6,7-trimethoxy-4H-1-benzopyran-4-one&& |
|CAS=973-67-1 | |CAS=973-67-1 | ||
|KNApSAcK=C00003808 | |KNApSAcK=C00003808 | ||
}} | }} | ||
Latest revision as of 13:16, 6 August 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FE9 5,6,7,(3'),(5')-Hydroxyflavone O-methyl derivatives (20 pages) : FL3FE9NS Simple substitution (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 973-67-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FE9NS0006.mol |
| 5,6,7-Trimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-Phenyl-5,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O5 |
| Exact Mass | 312.099773622 |
| Average Mass | 312.31664 |
| SMILES | c(c1OC)c(O2)c(C(=O)C=C2c(c3)cccc3)c(c1OC)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
