FL3FA9GS0004
From Metabolomics.JP
(Difference between revisions)
| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5-Hydroxyflavon-7-yl beta-D-glucopyranosiduronic acid |
| − | |Common Name=&&Chrysin 7-glucuronide&& | + | |Common Name=&&Chrysin 7-glucuronide&&5-Hydroxyflavon-7-yl beta-D-glucopyranosiduronic acid&& |
|CAS=35775-49-6 | |CAS=35775-49-6 | ||
|KNApSAcK=C00004112 | |KNApSAcK=C00004112 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FA9 5,7,(3'),(5')-Hydroxyflavone O-methyl derivatives (53 pages) : FL3FA9GS O-Glycoside (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 35775-49-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FA9GS0004.mol |
| Chrysin 7-glucuronide | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxyflavon-7-yl beta-D-glucopyranosiduronic acid |
| Common Name |
|
| Symbol | |
| Formula | C21H18O10 |
| Exact Mass | 430.089996796 |
| Average Mass | 430.36162 |
| SMILES | C(C(Oc(c4)cc(c(c4O)3)OC(=CC(=O)3)c(c2)cccc2)1)(O)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
