FL2FACGS0002
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5,7,3',4'-Tetrahydroxyflavanone 5-O-rhamnoside |
| − | |Common Name=&&Eriodictyol 5-O-rhamnoside&& | + | |Common Name=&&Eriodictyol 5-O-rhamnoside&&5,7,3',4'-Tetrahydroxyflavanone 5-O-rhamnoside&& |
|CAS=71481-42-0 | |CAS=71481-42-0 | ||
|KNApSAcK=C00008289 | |KNApSAcK=C00008289 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAC Eriodictyol (71 pages) : FL2FACGS O-Glycoside (18 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 71481-42-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FACGS0002.mol |
| Eriodictyol 5-O-rhamnoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3',4'-Tetrahydroxyflavanone 5-O-rhamnoside |
| Common Name |
|
| Symbol | |
| Formula | C21H22O10 |
| Exact Mass | 434.121296924 |
| Average Mass | 434.39338 |
| SMILES | C(=O)(C3)c(c2OC3c(c4)cc(c(O)c4)O)c(cc(O)c2)OC(O1)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
