FL2FAANF0004
From Metabolomics.JP
(Difference between revisions)
| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=(2S)- 2,3-Dihydro-5-hydroxy-8- (1-hydroxy-1-methylethyl) -2- (4-hydroxyphenyl) -6- (3-methyl-2-buten-1-yl) -4H-furo [2,3-h] -1-benzopyran-4-one |
| − | + | |Common Name=&&Lupineol&&(S) -2- (4-Hydroxyphenyl) -5-hydroxy-6- (3-methyl-2-butenyl) -8- (1-methyl-1-hydroxyethyl) -2H-furo [ 2,3-h ] -1-benzopyran-4 (3H) -one&& | |
|CAS=162616-69-5 | |CAS=162616-69-5 | ||
|KNApSAcK=C00008513 | |KNApSAcK=C00008513 | ||
}} | }} | ||
Latest revision as of 16:48, 10 August 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAA Naringenin (106 pages) : FL2FAANF Furanoflavonoid (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 162616-69-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FAANF0004.mol |
| Lupineol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S)- 2,3-Dihydro-5-hydroxy-8- (1-hydroxy-1-methylethyl) -2- (4-hydroxyphenyl) -6- (3-methyl-2-buten-1-yl) -4H-furo [2,3-h] -1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C25H26O6 |
| Exact Mass | 422.172938564 |
| Average Mass | 422.47033999999996 |
| SMILES | c(c23)(OC(c(c4)ccc(c4)O)CC3=O)c(c1c(c2O)CC=C(C)C)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
