FL1CHXNS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
| {{Metabolite | {{Metabolite | ||
| |SysName=3,4,2',4',alpha-Pentahydroxychalcone | |SysName=3,4,2',4',alpha-Pentahydroxychalcone | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CHX alpha-Hydroxychalcone (1 pages) : FL1CHXNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 38681-20-8 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CHXNS0001.mol | 
| 3,4,2',4',alpha-Pentahydroxychalcone | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | 3,4,2',4',alpha-Pentahydroxychalcone | 
| Common Name | 
 | 
| Symbol | |
| Formula | C15H12O6 | 
| Exact Mass | 288.063388116 | 
| Average Mass | 288.25218 | 
| SMILES | Oc(c2)cc(O)c(c2)C(=O)C(O)=Cc(c1)cc(O)c(O)c1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 
 | 
