Curcumin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione |Common Name=&&(E,E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene...) |
|||
| (One intermediate revision by one user not shown) | |||
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione | |SysName=(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione | ||
| − | |Common Name= | + | |Common Name=&&Curcumin&&(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione&&(E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione&&(E,E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione&&Curcuma&&Curcumin I&&Curcumine&&Diferuloylmethane&&trans,trans-Curcuminn&& |
|CAS=458-37-7 | |CAS=458-37-7 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 16:43, 21 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 458-37-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Curcumin.mol |
| Curcumin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione |
| Common Name |
|
| Symbol | |
| Formula | C21H20O6 |
| Exact Mass | 368.125988372 |
| Average Mass | 368.37989999999996 |
| SMILES | COc(c1)c(O)ccc(C=CC(=O)CC(=O)C=Cc(c2)cc(OC)c(O)c2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
