Alkannin
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,8-Dihydroxy-2-[(1S)-1-hydroxy-4-methyl-3-penten-1-yl]-1,4-naphthalenedione | |SysName=5,8-Dihydroxy-2-[(1S)-1-hydroxy-4-methyl-3-penten-1-yl]-1,4-naphthalenedione | ||
| − | |Common Name=&&(-)-Alkannin&&(S)-5,8-Dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-1,4-naphthalenedione&&5,8-Dihydroxy-2-[(1S)-1-hydroxy-4-methyl-3-pentenyl]-1,4-naphthalenedione&&(-)-5,8-Dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-1,4-naphthoquinone | + | |Common Name=&&Alkannin&&(-)-Alkannin&&(S)-5,8-Dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-1,4-naphthalenedione&&5,8-Dihydroxy-2-[(1S)-1-hydroxy-4-methyl-3-pentenyl]-1,4-naphthalenedione&&(-)-5,8-Dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-1,4-naphthoquinone&&Anchusa acid&&Anchusin&& |
|CAS=517-88-4 | |CAS=517-88-4 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 16:16, 21 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 517-88-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Alkannin.mol |
| Alkannin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,8-Dihydroxy-2-[(1S)-1-hydroxy-4-methyl-3-penten-1-yl]-1,4-naphthalenedione |
| Common Name |
|
| Symbol | |
| Formula | C16H16O5 |
| Exact Mass | 288.099773622 |
| Average Mass | 288.29524 |
| SMILES | CC(C)=CCC(O)c(c1)c(=O)c(c(O)2)c(c(O)cc2)c(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
