LBF20406LT03
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR3111 | |LipidBank=XPR3111 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR3111 |
| LipidMaps | LMFA03020024 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406LT03.mol |
| 12-oxo-Leukotriene B4 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5S-hydroxy-12-keto- [ 6Z, 8E, 10E, 14Z ] -eicosatetraenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H30O4 |
| Exact Mass | 334.21440944799997 |
| Average Mass | 334.4498 |
| SMILES | C(CC=CCC(C=CC=CC=C[C@H](CCCC(O)=O)O)=O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | Soluble in ethanol, methanol, ethyl acetate, acetonitril |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | UV maxima 316 nm, Absorbance at 320 nm is 41000/M |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | 12-oxo-LTB4 is eluted at 7.8 min on RP-HPLC system as follows: Solvent:acetonitril/water/acetic acid, 50:50:0.01 (v/v/v), 0.01 % (w/v) Na2EDTA, pH 5.6 with ammonia Flow: 1 ml/min, isocratic Column: Cosmosil 5C18-AR (4.6 x 150 mm, Nacalai tesque, Tokyo) <<3111>> |
