LBF20406HX01
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR5001 | |LipidBank=XPR5001 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR5001 |
| LipidMaps | LMFA03090005 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406HX01.mol |
| HEPOXILIN A3 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8-Hydroxy-11,12 (S,S) -epoxyeicosa-5,14 (Z,Z) ,9 (E) -trienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H32O4 |
| Exact Mass | 336.23005951199997 |
| Average Mass | 336.46567999999996 |
| SMILES | C(=C[C@@H](O)CC=CCCCC(O)=O)[C@@H](O1)[C@@H]1CC=CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | DIETHYL ETHER <<1071>> |
| Spectral Information | |
| Mass Spectra | METHYL ESTER TRIS-TMS ETHER ; m/e 422(M+), 407, 391, 332, 311, 282, 269(base peak) <<1070>> |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
