LBF20406HX01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR5001 | |LipidBank=XPR5001 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR5001 |
LipidMaps | LMFA03090005 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406HX01.mol |
HEPOXILIN A3 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 8-Hydroxy-11,12 (S,S) -epoxyeicosa-5,14 (Z,Z) ,9 (E) -trienoic acid |
Common Name |
|
Symbol | |
Formula | C20H32O4 |
Exact Mass | 336.23005951199997 |
Average Mass | 336.46567999999996 |
SMILES | C(=C[C@@H](O)CC=CCCCC(O)=O)[C@@H](O1)[C@@H]1CC=CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | DIETHYL ETHER <<1071>> |
Spectral Information | |
Mass Spectra | METHYL ESTER TRIS-TMS ETHER ; m/e 422(M+), 407, 391, 332, 311, 282, 269(base peak) <<1070>> |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |