LBF20406HO20
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR6101 | |LipidBank=XPR6101 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR6101 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406HO20.mol |
| |
| Structural Information | |
| Systematic Name | 5 (S) -Hydroxy-6,8,11,14- (E,Z,Z,Z) -eicosatetraenoic acid |
| Common Name | |
| Symbol | |
| Formula | C20H32O3 |
| Exact Mass | 320.23514489 |
| Average Mass | 320.46628 |
| SMILES | C(CC=CCC=CCC=CC=C[C@@H](CCCC(O)=O)O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | METHYL ESTER ; [a]XD23=+14.0°(C=2.0, BENZENE) <<1079>> |
| Solubility | DIETHYL ETHER <<1080>> |
| Spectral Information | |
| Mass Spectra | METHYL ESTER ETHER ; m/e 406(M+), 391, 375, 316, 305, 255, 216, 215, 203, 190, 155, 150, 143, 136, 105, 80, 79 <<1080>> |
| UV Spectra | METHYL ESTER ; l MeOHmax = 235nm (e 30,500) <<1080>> |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
