LBF20406AM35
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7052 | |LipidBank=XPR7052 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7052 |
| LipidMaps | LMFA08020038 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM35.mol |
| |
| Structural Information | |
| Systematic Name | N- ( (R) - (-) -1-methyl-2-hydroxyethyl) a ,a -dimethylarachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO2 |
| Exact Mass | 389.329379625 |
| Average Mass | 389.61446 |
| SMILES | C(=CCC=CCC=CCC=CCCCCC)CCC(C)(C)C(N[C@H](CO)C)=O |
| Physicochemical Information | |
| Melting Point | colorless oil<<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.80 (br s, lH), 5.30-5.42 (m, 8H), 4.01-4.12 (m, lH), 3.60-3.68 (m, lH), 3.50-3.55 (m, lH), 2.98-3.01 (m, lH), 2.76-2.84 (m, 6H), 1.90-2.10 (m, 4H), 1.15-1.62 (series of m, l7H), 0.90 (t, J=7.1Hz, 3H). <<7001>> |
| Chromatograms | |
