LBF20406AM29
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7046 | |LipidBank=XPR7046 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7046 |
| LipidMaps | - |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM29.mol |
| |
| Structural Information | |
| Systematic Name | alpha,alpha-dimethyl anandamide |
| Common Name | |
| Symbol | |
| Formula | C24H41NO2 |
| Exact Mass | 375.313729561 |
| Average Mass | 375.58788 |
| SMILES | C(CC=CCCC(C(NCCO)=O)(C)C)=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil<<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d6.10 (br s, lH), 5.30-5.42 (m, 8H), 3.75 (t, J=5.l Hz, 2H), 3.42 (q, J=4.9Hz, 2H), 2.78-2.86 (m, 6H), 2.00-2.10 (m, 4H), 1.50-1.62 (m, 4H), 1.24-1.40 (m, 4H), 1.22 (s, 6H), 0.90 (t, J=6.9 Hz, 3H). <<7001>> |
| Chromatograms | |
