LBF20406AM26
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7042 | |LipidBank=XPR7042 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7042 |
| LipidMaps | LMFA08020028 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM26.mol |
| |
| Structural Information | |
| Systematic Name | N,N- (di-2-hydroxyethyl) arachidonoylamide |
| Common Name | |
| Symbol | |
| Formula | C24H41NO3 |
| Exact Mass | 391.30864418299996 |
| Average Mass | 391.58727999999996 |
| SMILES | C(CN(CCO)C(CCCC=CCC=CCC=CCC=CCCCCC)=O)O |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.60-5.42 (m, 8H), 3.83 (t, J=4.9Hz, 2H), 3.77 (t, J=5.lHz, 2H), 3.54(t, J=5.1Hz, 2H), 3.49 (t, J=4.9Hz, 2H), 2.77-2.86 (m, 6H), 2.40 (t, J=7.3Hz, 2H), 2.02-2.16 (m, 4H), 1.69-1.76 (m, 2H), 1.25-1.38 (m, 6H), 0.88 (t, J=6.6Hz, 3H). <<7001>> |
| Chromatograms | |
