LBF20406AM26
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7042 | |LipidBank=XPR7042 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7042 |
LipidMaps | LMFA08020028 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM26.mol |
![]() | |
Structural Information | |
Systematic Name | N,N- (di-2-hydroxyethyl) arachidonoylamide |
Common Name | |
Symbol | |
Formula | C24H41NO3 |
Exact Mass | 391.30864418299996 |
Average Mass | 391.58727999999996 |
SMILES | C(CN(CCO)C(CCCC=CCC=CCC=CCC=CCCCCC)=O)O |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.60-5.42 (m, 8H), 3.83 (t, J=4.9Hz, 2H), 3.77 (t, J=5.lHz, 2H), 3.54(t, J=5.1Hz, 2H), 3.49 (t, J=4.9Hz, 2H), 2.77-2.86 (m, 6H), 2.40 (t, J=7.3Hz, 2H), 2.02-2.16 (m, 4H), 1.69-1.76 (m, 2H), 1.25-1.38 (m, 6H), 0.88 (t, J=6.6Hz, 3H). <<7001>> |
Chromatograms |