LBF20406AM15
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7031 | |LipidBank=XPR7031 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7031 |
| LipidMaps | LMFA08020017 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM15.mol |
| |
| Structural Information | |
| Systematic Name | N- ( (S) - (+) -1-methylpropyl) arachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C24H41NO |
| Exact Mass | 359.318814939 |
| Average Mass | 359.58847999999995 |
| SMILES | C(=CCCCC(=O)N[C@H](CC)C)CC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<0001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | dX425= +7.08° (C=1, EtOH) <<0001>> |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.30-5.42 (m, 8H), 5.22 (br s, lH), 3.88-3.98 (m, lH), 2.75-2.90 (m, 6H), 2.00-2.20 (m, 6H), 1.65-1.76 (m, 2H), 1.22-1.50 (m, 8H), 1.12 (d, J=7.5Hz, 3H), 0.82-0.96 (m, 6H). <<7001>> |
| Chromatograms | |
