LBF20406AM11
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7027 | |LipidBank=XPR7027 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7027 |
LipidMaps | LMFA08020013 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM11.mol |
![]() | |
Structural Information | |
Systematic Name | N-amyl arachidohoyl amide |
Common Name | |
Symbol | |
Formula | C25H43NO |
Exact Mass | 373.334465003 |
Average Mass | 373.61505999999997 |
SMILES | C(CCCNC(CCCC=CCC=CCC=CCC=CCCCCC)=O)C |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.70 (br s lH), 5.23-5.33 (m, 8H), 3.15 (q, J=3Hz, 2H), 2.71-2.77(m, 6H), 1.97-2.16 (m, 6H), 1.58-1.68 (m, 2H), 1.18-1.42 (m, l2H), 0.79-0.85 (m, 6H). <<7001>> |
Chromatograms |