LBF20109BC01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7103 | |LipidBank=DFA7103 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA7103 |
LipidMaps | LMFA01020135 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20109BC01.mol |
![]() | |
Structural Information | |
Systematic Name | 2-Propyl Octadec-9- (Z) -Enoic Acid |
Common Name | |
Symbol | |
Formula | C21H40O2 |
Exact Mass | 324.302830524 |
Average Mass | 324.5411 |
SMILES | C(CCCCC=CCCCCCCC(CCC)C(O)=O)CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | 193 - 195°C/0.5 - 1mmHg <<7105>> |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |