LBF18206SC05
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0159 | |LipidBank=DFA0159 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0159 |
| LipidMaps | LMFA01030120 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18206SC05.mol |
| Linoleic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-9, cis-12-Octadecadienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCCC=CCC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | -5°C |
| Boiling Point | 229°C to 230°C at 16mmHg |
| Density | dX420 0.9031 |
| Optical Rotation | 1.4711 at 20°C |
| Reflactive Index | |
| Solubility | soluble in acetone, alcohol, ether and petroleum ether.<<0193>><<0351>><<0378>><<0409>><<0410>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | Gas liquid chromatogram (provided by Dr. Akiko Horiuchi). |
