LBF16000BC06
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7013 | |LipidBank=DFA7013 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA7013 |
LipidMaps | LMFA01020045 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF16000BC06.mol |
![]() | |
Structural Information | |
Systematic Name | 4,14-Dimethylhexadecanoic Acid |
Common Name | |
Symbol | |
Formula | C18H36O2 |
Exact Mass | 284.271530396 |
Average Mass | 284.47724 |
SMILES | CCC(C)CCCCCCCCCC(C)CCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | ![]() (provided by Dr. Takeshi Kasama). |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms | Gas chromatography <<7145>> |