FLIE9CNM0001
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=8,9-Dihydroxy-1-methylcoumestan |
| − | |Common Name=&&8,9-Dihydroxy-1-methylcoumestan | + | |Common Name=&&Mutisifurocoumarin&&8,9-Dihydroxy-1-methylcoumestan&& |
|CAS=115532-07-5 | |CAS=115532-07-5 | ||
|KNApSAcK=C00010060 | |KNApSAcK=C00010060 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIE Coumestan : FLIE9C (1),(2),(4),8,9-Hydroxycoumestan O-methyl derivatives (0 pages) : FLIE9CNM C-Methyl or C2/C3 substituted (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 115532-07-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIE9CNM0001.mol |
| Mutisifurocoumarin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8,9-Dihydroxy-1-methylcoumestan |
| Common Name |
|
| Symbol | |
| Formula | C16H10O5 |
| Exact Mass | 282.05282343 |
| Average Mass | 282.2476 |
| SMILES | Oc(c4)c(O)cc(c43)c(C(=O)1)c(o3)c(c(C)2)c(ccc2)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
